C17H18FNO3 — CID 82320063
3-[N-[(3-fluorophenyl)methyl]-3-methoxyanilino]propanoic acid (PubChem CID 82320063) has the molecular formula C17H18FNO3 and a molecular weight of 303.33 g/mol. Its IUPAC name is 3-[N-[(3-fluorophenyl)methyl]-3-methoxyanilino]propanoic acid.
| Compound Name | 3-[N-[(3-fluorophenyl)methyl]-3-methoxyanilino]propanoic acid |
|---|---|
| PubChem CID | 82320063 |
| Molecular Formula | C17H18FNO3 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 3-[N-[(3-fluorophenyl)methyl]-3-methoxyanilino]propanoic acid |
| SMILES | COc1cccc(N(CCC(=O)O)Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C17H18FNO3/c1-22-16-7-3-6-15(11-16)19(9-8-17(20)21)12-13-4-2-5-14(18)10-13/h2-7,10-11H,8-9,12H2,1H3,(H,20,21) |
| InChIKey | OUIBDRZZRHHVGQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |