3-[1,3-benzodioxol-5-yl(butanoyl)amino]-2-methylpropanoic acid

C15H19NO5 — CID 82320810

IUPAC3-[1,3-benzodioxol-5-yl(butanoyl)amino]-2-methylpropanoic acid
SMILESCCCC(=O)N(CC(C)C(=O)O)c1ccc2c(c1)OCO2
InChIInChI=1S/C15H19NO5/c1-3-4-14(17)16(8-10(2)15(18)19)11-5-6-12-13(7-11)21-9-20-12/h5-7,10H,3-4,8-9H2,1-2H3,(H,18,19)
InChIKeyOYXDVRYIANRYTJ-UHFFFAOYSA-N
MW293.32 g/mol
LogP2.27
Rot. Bonds6

About 3-[1,3-benzodioxol-5-yl(butanoyl)amino]-2-methylpropanoic acid

3-[1,3-benzodioxol-5-yl(butanoyl)amino]-2-methylpropanoic acid (PubChem CID 82320810) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 3-[1,3-benzodioxol-5-yl(butanoyl)amino]-2-methylpropanoic acid.

Molecular Properties

Compound Name3-[1,3-benzodioxol-5-yl(butanoyl)amino]-2-methylpropanoic acid
PubChem CID82320810
Molecular FormulaC15H19NO5
Molecular Weight293.32 g/mol
Exact Mass293.13
IUPAC Name3-[1,3-benzodioxol-5-yl(butanoyl)amino]-2-methylpropanoic acid
SMILESCCCC(=O)N(CC(C)C(=O)O)c1ccc2c(c1)OCO2
InChIInChI=1S/C15H19NO5/c1-3-4-14(17)16(8-10(2)15(18)19)11-5-6-12-13(7-11)21-9-20-12/h5-7,10H,3-4,8-9H2,1-2H3,(H,18,19)
InChIKeyOYXDVRYIANRYTJ-UHFFFAOYSA-N
XLogP2.27
TPSA76.07 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.32
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[1,3-benzodioxol-5-yl(butanoyl)amino]-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[1,3-benzodioxol-5-yl(butanoyl)amino]-2-methylpropanoic acid?
The IUPAC name of 3-[1,3-benzodioxol-5-yl(butanoyl)amino]-2-methylpropanoic acid (CID 82320810) is 3-[1,3-benzodioxol-5-yl(butanoyl)amino]-2-methylpropanoic acid.
What is the SMILES notation for 3-[1,3-benzodioxol-5-yl(butanoyl)amino]-2-methylpropanoic acid?
The canonical SMILES for 3-[1,3-benzodioxol-5-yl(butanoyl)amino]-2-methylpropanoic acid is CCCC(=O)N(CC(C)C(=O)O)c1ccc2c(c1)OCO2.
What is the InChIKey of 3-[1,3-benzodioxol-5-yl(butanoyl)amino]-2-methylpropanoic acid?
The InChIKey is OYXDVRYIANRYTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO5/c1-3-4-14(17)16(8-10(2)15(18)19)11-5-6-12-13(7-11)21-9-20-12/h5-7,10H,3-4,8-9H2,1-2H3,(H,18,19).
What are the key properties of 3-[1,3-benzodioxol-5-yl(butanoyl)amino]-2-methylpropanoic acid?
3-[1,3-benzodioxol-5-yl(butanoyl)amino]-2-methylpropanoic acid has a molecular weight of 293.32 g/mol, XLogP of 2.27, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,3-benzodioxol-5-yl(butanoyl)amino]-2-methylpropanoic acid is sourced from PubChem (CID 82320810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).