3-[2,6-difluoro-N-(3-methylbutanoyl)anilino]propanoic acid

C14H17F2NO3 — CID 82321349

IUPAC3-[2,6-difluoro-N-(3-methylbutanoyl)anilino]propanoic acid
SMILESCC(C)CC(=O)N(CCC(=O)O)c1c(F)cccc1F
InChIInChI=1S/C14H17F2NO3/c1-9(2)8-12(18)17(7-6-13(19)20)14-10(15)4-3-5-11(14)16/h3-5,9H,6-8H2,1-2H3,(H,19,20)
InChIKeyZTPOEZMWECVQPI-UHFFFAOYSA-N
MW285.29 g/mol
LogP2.82
Rot. Bonds6

About 3-[2,6-difluoro-N-(3-methylbutanoyl)anilino]propanoic acid

3-[2,6-difluoro-N-(3-methylbutanoyl)anilino]propanoic acid (PubChem CID 82321349) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is 3-[2,6-difluoro-N-(3-methylbutanoyl)anilino]propanoic acid.

Molecular Properties

Compound Name3-[2,6-difluoro-N-(3-methylbutanoyl)anilino]propanoic acid
PubChem CID82321349
Molecular FormulaC14H17F2NO3
Molecular Weight285.29 g/mol
Exact Mass285.12
IUPAC Name3-[2,6-difluoro-N-(3-methylbutanoyl)anilino]propanoic acid
SMILESCC(C)CC(=O)N(CCC(=O)O)c1c(F)cccc1F
InChIInChI=1S/C14H17F2NO3/c1-9(2)8-12(18)17(7-6-13(19)20)14-10(15)4-3-5-11(14)16/h3-5,9H,6-8H2,1-2H3,(H,19,20)
InChIKeyZTPOEZMWECVQPI-UHFFFAOYSA-N
XLogP2.82
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.29
LogP ≤ 52.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-[2,6-difluoro-N-(3-methylbutanoyl)anilino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2,6-difluoro-N-(3-methylbutanoyl)anilino]propanoic acid?
The IUPAC name of 3-[2,6-difluoro-N-(3-methylbutanoyl)anilino]propanoic acid (CID 82321349) is 3-[2,6-difluoro-N-(3-methylbutanoyl)anilino]propanoic acid.
What is the SMILES notation for 3-[2,6-difluoro-N-(3-methylbutanoyl)anilino]propanoic acid?
The canonical SMILES for 3-[2,6-difluoro-N-(3-methylbutanoyl)anilino]propanoic acid is CC(C)CC(=O)N(CCC(=O)O)c1c(F)cccc1F.
What is the InChIKey of 3-[2,6-difluoro-N-(3-methylbutanoyl)anilino]propanoic acid?
The InChIKey is ZTPOEZMWECVQPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2NO3/c1-9(2)8-12(18)17(7-6-13(19)20)14-10(15)4-3-5-11(14)16/h3-5,9H,6-8H2,1-2H3,(H,19,20).
What are the key properties of 3-[2,6-difluoro-N-(3-methylbutanoyl)anilino]propanoic acid?
3-[2,6-difluoro-N-(3-methylbutanoyl)anilino]propanoic acid has a molecular weight of 285.29 g/mol, XLogP of 2.82, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,6-difluoro-N-(3-methylbutanoyl)anilino]propanoic acid is sourced from PubChem (CID 82321349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).