C12H11FN4O3 — CID 82321614
3-[(2-fluorobenzoyl)-(1H-1,2,4-triazol-5-yl)amino]propanoic acid (PubChem CID 82321614) has the molecular formula C12H11FN4O3 and a molecular weight of 278.24 g/mol. Its IUPAC name is 3-[(2-fluorobenzoyl)-(1H-1,2,4-triazol-5-yl)amino]propanoic acid.
| Compound Name | 3-[(2-fluorobenzoyl)-(1H-1,2,4-triazol-5-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 82321614 |
| Molecular Formula | C12H11FN4O3 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 3-[(2-fluorobenzoyl)-(1H-1,2,4-triazol-5-yl)amino]propanoic acid |
| SMILES | O=C(O)CCN(C(=O)c1ccccc1F)c1ncn[nH]1 |
| InChI | InChI=1S/C12H11FN4O3/c13-9-4-2-1-3-8(9)11(20)17(6-5-10(18)19)12-14-7-15-16-12/h1-4,7H,5-6H2,(H,18,19)(H,14,15,16) |
| InChIKey | XWAJKRXOOKIQDB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |