C17H25NO3 — CID 82322368
3-(butylamino)-4-oxo-4-(4-propan-2-ylphenyl)butanoic acid (PubChem CID 82322368) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 3-(butylamino)-4-oxo-4-(4-propan-2-ylphenyl)butanoic acid.
| Compound Name | 3-(butylamino)-4-oxo-4-(4-propan-2-ylphenyl)butanoic acid |
|---|---|
| PubChem CID | 82322368 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 3-(butylamino)-4-oxo-4-(4-propan-2-ylphenyl)butanoic acid |
| SMILES | CCCCNC(CC(=O)O)C(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C17H25NO3/c1-4-5-10-18-15(11-16(19)20)17(21)14-8-6-13(7-9-14)12(2)3/h6-9,12,15,18H,4-5,10-11H2,1-3H3,(H,19,20) |
| InChIKey | GHLRGPQBPTYJDL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|