About 5-[[4-(2-carboxyethyl)-1,4-diazepan-1-yl]methyl]furan-2-carboxylic acid
5-[[4-(2-carboxyethyl)-1,4-diazepan-1-yl]methyl]furan-2-carboxylic acid (PubChem CID 82323103) has the molecular formula C14H20N2O5
and a molecular weight of 296.32 g/mol. Its IUPAC name is 5-[[4-(2-carboxyethyl)-1,4-diazepan-1-yl]methyl]furan-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[4-(2-carboxyethyl)-1,4-diazepan-1-yl]methyl]furan-2-carboxylic acid |
| PubChem CID | 82323103 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 5-[[4-(2-carboxyethyl)-1,4-diazepan-1-yl]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)CCN1CCCN(Cc2ccc(C(=O)O)o2)CC1 |
| InChI | InChI=1S/C14H20N2O5/c17-13(18)4-7-15-5-1-6-16(9-8-15)10-11-2-3-12(21-11)14(19)20/h2-3H,1,4-10H2,(H,17,18)(H,19,20) |
| InChIKey | SKGOMPJCURWRHO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[4-(2-carboxyethyl)-1,4-diazepan-1-yl]methyl]furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-(2-carboxyethyl)-1,4-diazepan-1-yl]methyl]furan-2-carboxylic acid?
The IUPAC name of 5-[[4-(2-carboxyethyl)-1,4-diazepan-1-yl]methyl]furan-2-carboxylic acid (CID 82323103) is 5-[[4-(2-carboxyethyl)-1,4-diazepan-1-yl]methyl]furan-2-carboxylic acid.
What is the SMILES notation for 5-[[4-(2-carboxyethyl)-1,4-diazepan-1-yl]methyl]furan-2-carboxylic acid?
The canonical SMILES for 5-[[4-(2-carboxyethyl)-1,4-diazepan-1-yl]methyl]furan-2-carboxylic acid is O=C(O)CCN1CCCN(Cc2ccc(C(=O)O)o2)CC1.
What is the InChIKey of 5-[[4-(2-carboxyethyl)-1,4-diazepan-1-yl]methyl]furan-2-carboxylic acid?
The InChIKey is SKGOMPJCURWRHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O5/c17-13(18)4-7-15-5-1-6-16(9-8-15)10-11-2-3-12(21-11)14(19)20/h2-3H,1,4-10H2,(H,17,18)(H,19,20).
What are the key properties of 5-[[4-(2-carboxyethyl)-1,4-diazepan-1-yl]methyl]furan-2-carboxylic acid?
5-[[4-(2-carboxyethyl)-1,4-diazepan-1-yl]methyl]furan-2-carboxylic acid has a molecular weight of 296.32 g/mol, XLogP of 0.96, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-(2-carboxyethyl)-1,4-diazepan-1-yl]methyl]furan-2-carboxylic acid is sourced from PubChem (CID 82323103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).