About 3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid
3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid (PubChem CID 82325834) has the molecular formula C8H10F3NO3
and a molecular weight of 225.17 g/mol. Its IUPAC name is 3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid |
| PubChem CID | 82325834 |
| Molecular Formula | C8H10F3NO3 |
| Molecular Weight | 225.17 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid |
| SMILES | C=CCN(CCC(=O)O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO3/c1-2-4-12(5-3-6(13)14)7(15)8(9,10)11/h2H,1,3-5H2,(H,13,14) |
| InChIKey | XOAQESSDFOIXEZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.17 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid?
The IUPAC name of 3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid (CID 82325834) is 3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid.
What is the SMILES notation for 3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid?
The canonical SMILES for 3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid is C=CCN(CCC(=O)O)C(=O)C(F)(F)F.
What is the InChIKey of 3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid?
The InChIKey is XOAQESSDFOIXEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3NO3/c1-2-4-12(5-3-6(13)14)7(15)8(9,10)11/h2H,1,3-5H2,(H,13,14).
What are the key properties of 3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid?
3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid has a molecular weight of 225.17 g/mol, XLogP of 1.04, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid is sourced from PubChem (CID 82325834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).