About 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-pyridinyl)acetamide
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-pyridinyl)acetamide (PubChem CID 823264) has the molecular formula C12H12BrClN4O
and a molecular weight of 343.61 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-pyridinyl)acetamide.
Molecular Properties
| Compound Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-pyridinyl)acetamide |
| PubChem CID | 823264 |
| Molecular Formula | C12H12BrClN4O |
| Molecular Weight | 343.61 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-pyridinyl)acetamide |
| SMILES | Cc1nn(CC(=O)Nc2ccc(Cl)cn2)c(C)c1Br |
| InChI | InChI=1S/C12H12BrClN4O/c1-7-12(13)8(2)18(17-7)6-11(19)16-10-4-3-9(14)5-15-10/h3-5H,6H2,1-2H3,(H,15,16,19) |
| InChIKey | KAJOYLQRBAIYSQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-pyridinyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-pyridinyl)acetamide?
The IUPAC name of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-pyridinyl)acetamide (CID 823264) is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-pyridinyl)acetamide.
What is the SMILES notation for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-pyridinyl)acetamide?
The canonical SMILES for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-pyridinyl)acetamide is Cc1nn(CC(=O)Nc2ccc(Cl)cn2)c(C)c1Br.
What is the InChIKey of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-pyridinyl)acetamide?
The InChIKey is KAJOYLQRBAIYSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrClN4O/c1-7-12(13)8(2)18(17-7)6-11(19)16-10-4-3-9(14)5-15-10/h3-5H,6H2,1-2H3,(H,15,16,19).
What are the key properties of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-pyridinyl)acetamide?
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-pyridinyl)acetamide has a molecular weight of 343.61 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-pyridinyl)acetamide is sourced from PubChem (CID 823264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).