About 2-cyano-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide
2-cyano-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide (PubChem CID 823292) has the molecular formula C17H22N2O3
and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-cyano-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide.
Molecular Properties
| Compound Name | 2-cyano-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide |
| PubChem CID | 823292 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-cyano-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide |
| SMILES | COc1ccc(C2(CNC(=O)CC#N)CCCC2)cc1OC |
| InChI | InChI=1S/C17H22N2O3/c1-21-14-6-5-13(11-15(14)22-2)17(8-3-4-9-17)12-19-16(20)7-10-18/h5-6,11H,3-4,7-9,12H2,1-2H3,(H,19,20) |
| InChIKey | KGDYWNIGJJQVOG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyano-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide?
The IUPAC name of 2-cyano-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide (CID 823292) is 2-cyano-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide.
What is the SMILES notation for 2-cyano-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide?
The canonical SMILES for 2-cyano-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide is COc1ccc(C2(CNC(=O)CC#N)CCCC2)cc1OC.
What is the InChIKey of 2-cyano-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide?
The InChIKey is KGDYWNIGJJQVOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O3/c1-21-14-6-5-13(11-15(14)22-2)17(8-3-4-9-17)12-19-16(20)7-10-18/h5-6,11H,3-4,7-9,12H2,1-2H3,(H,19,20).
What are the key properties of 2-cyano-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide?
2-cyano-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide has a molecular weight of 302.37 g/mol, XLogP of 2.55, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide is sourced from PubChem (CID 823292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).