C19H23N3 — CID 82333100
[4-(1-butyl-5-methylbenzimidazol-2-yl)phenyl]methanamine (PubChem CID 82333100) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is [4-(1-butyl-5-methylbenzimidazol-2-yl)phenyl]methanamine.
| Compound Name | [4-(1-butyl-5-methylbenzimidazol-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 82333100 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | [4-(1-butyl-5-methylbenzimidazol-2-yl)phenyl]methanamine |
| SMILES | CCCCn1c(-c2ccc(CN)cc2)nc2cc(C)ccc21 |
| InChI | InChI=1S/C19H23N3/c1-3-4-11-22-18-10-5-14(2)12-17(18)21-19(22)16-8-6-15(13-20)7-9-16/h5-10,12H,3-4,11,13,20H2,1-2H3 |
| InChIKey | PKAQBVGKFRHILL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |