C17H27N3O — CID 82335320
N-[2-(1-ethyl-5-propan-2-yloxybenzimidazol-2-yl)ethyl]propan-1-amine (PubChem CID 82335320) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is N-[2-(1-ethyl-5-propan-2-yloxybenzimidazol-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(1-ethyl-5-propan-2-yloxybenzimidazol-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 82335320 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | N-[2-(1-ethyl-5-propan-2-yloxybenzimidazol-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNCCc1nc2cc(OC(C)C)ccc2n1CC |
| InChI | InChI=1S/C17H27N3O/c1-5-10-18-11-9-17-19-15-12-14(21-13(3)4)7-8-16(15)20(17)6-2/h7-8,12-13,18H,5-6,9-11H2,1-4H3 |
| InChIKey | FHXHPLRYDYNDPD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|