About 1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-N,N-dimethylethanamine
1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-N,N-dimethylethanamine (PubChem CID 82336590) has the molecular formula C13H19N3O2
and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-N,N-dimethylethanamine |
| PubChem CID | 82336590 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-N,N-dimethylethanamine |
| SMILES | COc1cc2nc(C(C)N(C)C)[nH]c2cc1OC |
| InChI | InChI=1S/C13H19N3O2/c1-8(16(2)3)13-14-9-6-11(17-4)12(18-5)7-10(9)15-13/h6-8H,1-5H3,(H,14,15) |
| InChIKey | VKQBSZBOYRPGRD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-N,N-dimethylethanamine?
The IUPAC name of 1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-N,N-dimethylethanamine (CID 82336590) is 1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-N,N-dimethylethanamine?
The canonical SMILES for 1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-N,N-dimethylethanamine is COc1cc2nc(C(C)N(C)C)[nH]c2cc1OC.
What is the InChIKey of 1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-N,N-dimethylethanamine?
The InChIKey is VKQBSZBOYRPGRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2/c1-8(16(2)3)13-14-9-6-11(17-4)12(18-5)7-10(9)15-13/h6-8H,1-5H3,(H,14,15).
What are the key properties of 1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-N,N-dimethylethanamine?
1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-N,N-dimethylethanamine has a molecular weight of 249.31 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 82336590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).