About 2-[1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl-methylamino]ethanol
2-[1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl-methylamino]ethanol (PubChem CID 82336620) has the molecular formula C12H15F2N3O
and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-[1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl-methylamino]ethanol.
Molecular Properties
| Compound Name | 2-[1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl-methylamino]ethanol |
| PubChem CID | 82336620 |
| Molecular Formula | C12H15F2N3O |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 2-[1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl-methylamino]ethanol |
| SMILES | CC(c1nc2cc(F)c(F)cc2[nH]1)N(C)CCO |
| InChI | InChI=1S/C12H15F2N3O/c1-7(17(2)3-4-18)12-15-10-5-8(13)9(14)6-11(10)16-12/h5-7,18H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | KQRDFRITWJFJND-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl-methylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl-methylamino]ethanol?
The IUPAC name of 2-[1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl-methylamino]ethanol (CID 82336620) is 2-[1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl-methylamino]ethanol.
What is the SMILES notation for 2-[1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl-methylamino]ethanol?
The canonical SMILES for 2-[1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl-methylamino]ethanol is CC(c1nc2cc(F)c(F)cc2[nH]1)N(C)CCO.
What is the InChIKey of 2-[1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl-methylamino]ethanol?
The InChIKey is KQRDFRITWJFJND-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2N3O/c1-7(17(2)3-4-18)12-15-10-5-8(13)9(14)6-11(10)16-12/h5-7,18H,3-4H2,1-2H3,(H,15,16).
What are the key properties of 2-[1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl-methylamino]ethanol?
2-[1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl-methylamino]ethanol has a molecular weight of 255.27 g/mol, XLogP of 1.83, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl-methylamino]ethanol is sourced from PubChem (CID 82336620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).