C15H21F2N3 — CID 82336897
N-[2-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl]hexan-1-amine (PubChem CID 82336897) has the molecular formula C15H21F2N3 and a molecular weight of 281.35 g/mol. Its IUPAC name is N-[2-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl]hexan-1-amine.
| Compound Name | N-[2-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl]hexan-1-amine |
|---|---|
| PubChem CID | 82336897 |
| Molecular Formula | C15H21F2N3 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | N-[2-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl]hexan-1-amine |
| SMILES | CCCCCCNCCc1nc2cc(F)c(F)cc2[nH]1 |
| InChI | InChI=1S/C15H21F2N3/c1-2-3-4-5-7-18-8-6-15-19-13-9-11(16)12(17)10-14(13)20-15/h9-10,18H,2-8H2,1H3,(H,19,20) |
| InChIKey | ARFKDSQAEKNIDT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|