About 2-(methoxymethyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine
2-(methoxymethyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine (PubChem CID 82337499) has the molecular formula C8H9N3O2
and a molecular weight of 179.18 g/mol. Its IUPAC name is 2-(methoxymethyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine.
Molecular Properties
| Compound Name | 2-(methoxymethyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine |
| PubChem CID | 82337499 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 2-(methoxymethyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine |
| SMILES | COCc1nc2ncc(N)cc2o1 |
| InChI | InChI=1S/C8H9N3O2/c1-12-4-7-11-8-6(13-7)2-5(9)3-10-8/h2-3H,4,9H2,1H3 |
| InChIKey | QERGRQVBIWRFHH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(methoxymethyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine?
The IUPAC name of 2-(methoxymethyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine (CID 82337499) is 2-(methoxymethyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine.
What is the SMILES notation for 2-(methoxymethyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine?
The canonical SMILES for 2-(methoxymethyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine is COCc1nc2ncc(N)cc2o1.
What is the InChIKey of 2-(methoxymethyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine?
The InChIKey is QERGRQVBIWRFHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2/c1-12-4-7-11-8-6(13-7)2-5(9)3-10-8/h2-3H,4,9H2,1H3.
What are the key properties of 2-(methoxymethyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine?
2-(methoxymethyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine has a molecular weight of 179.18 g/mol, XLogP of 0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine is sourced from PubChem (CID 82337499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).