C15H14N2O — CID 82337860
6-methyl-2-(2-phenylethyl)-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 82337860) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 6-methyl-2-(2-phenylethyl)-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 6-methyl-2-(2-phenylethyl)-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 82337860 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 6-methyl-2-(2-phenylethyl)-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | Cc1cnc2oc(CCc3ccccc3)nc2c1 |
| InChI | InChI=1S/C15H14N2O/c1-11-9-13-15(16-10-11)18-14(17-13)8-7-12-5-3-2-4-6-12/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | YQJKSECTFNZBPH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |