About propyl 2-[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propanoate
propyl 2-[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propanoate (PubChem CID 82339248) has the molecular formula C15H22N2O3
and a molecular weight of 278.35 g/mol. Its IUPAC name is propyl 2-[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propanoate.
Molecular Properties
| Compound Name | propyl 2-[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propanoate |
| PubChem CID | 82339248 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | propyl 2-[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propanoate |
| SMILES | CCCOC(=O)C(C)N1CCOc2cc(CN)ccc21 |
| InChI | InChI=1S/C15H22N2O3/c1-3-7-20-15(18)11(2)17-6-8-19-14-9-12(10-16)4-5-13(14)17/h4-5,9,11H,3,6-8,10,16H2,1-2H3 |
| InChIKey | ZHRVXNKIJFSXHO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propyl 2-[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propanoate?
The IUPAC name of propyl 2-[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propanoate (CID 82339248) is propyl 2-[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propanoate.
What is the SMILES notation for propyl 2-[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propanoate?
The canonical SMILES for propyl 2-[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propanoate is CCCOC(=O)C(C)N1CCOc2cc(CN)ccc21.
What is the InChIKey of propyl 2-[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propanoate?
The InChIKey is ZHRVXNKIJFSXHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3/c1-3-7-20-15(18)11(2)17-6-8-19-14-9-12(10-16)4-5-13(14)17/h4-5,9,11H,3,6-8,10,16H2,1-2H3.
What are the key properties of propyl 2-[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propanoate?
propyl 2-[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propanoate has a molecular weight of 278.35 g/mol, XLogP of 1.69, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propanoate is sourced from PubChem (CID 82339248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).