C17H24N2O3 — CID 82339706
2,4-diethyl-6-[hydroxy(pyrrolidin-2-yl)methyl]-1,4-benzoxazin-3-one (PubChem CID 82339706) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2,4-diethyl-6-[hydroxy(pyrrolidin-2-yl)methyl]-1,4-benzoxazin-3-one.
| Compound Name | 2,4-diethyl-6-[hydroxy(pyrrolidin-2-yl)methyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82339706 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2,4-diethyl-6-[hydroxy(pyrrolidin-2-yl)methyl]-1,4-benzoxazin-3-one |
| SMILES | CCC1Oc2ccc(C(O)C3CCCN3)cc2N(CC)C1=O |
| InChI | InChI=1S/C17H24N2O3/c1-3-14-17(21)19(4-2)13-10-11(7-8-15(13)22-14)16(20)12-6-5-9-18-12/h7-8,10,12,14,16,18,20H,3-6,9H2,1-2H3 |
| InChIKey | JJIIFXWJCAKUJU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |