C17H26N2O2 — CID 82340267
piperidin-3-yl-(2,2,4-trimethyl-3H-1,4-benzoxazin-6-yl)methanol (PubChem CID 82340267) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is piperidin-3-yl-(2,2,4-trimethyl-3H-1,4-benzoxazin-6-yl)methanol.
| Compound Name | piperidin-3-yl-(2,2,4-trimethyl-3H-1,4-benzoxazin-6-yl)methanol |
|---|---|
| PubChem CID | 82340267 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | piperidin-3-yl-(2,2,4-trimethyl-3H-1,4-benzoxazin-6-yl)methanol |
| SMILES | CN1CC(C)(C)Oc2ccc(C(O)C3CCCNC3)cc21 |
| InChI | InChI=1S/C17H26N2O2/c1-17(2)11-19(3)14-9-12(6-7-15(14)21-17)16(20)13-5-4-8-18-10-13/h6-7,9,13,16,18,20H,4-5,8,10-11H2,1-3H3 |
| InChIKey | MUUSTRZGUMBRKD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |