C14H19NO2 — CID 82340291
1-(2,2,4-trimethyl-3H-1,4-benzoxazin-6-yl)propan-1-one (PubChem CID 82340291) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(2,2,4-trimethyl-3H-1,4-benzoxazin-6-yl)propan-1-one.
| Compound Name | 1-(2,2,4-trimethyl-3H-1,4-benzoxazin-6-yl)propan-1-one |
|---|---|
| PubChem CID | 82340291 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-(2,2,4-trimethyl-3H-1,4-benzoxazin-6-yl)propan-1-one |
| SMILES | CCC(=O)c1ccc2c(c1)N(C)CC(C)(C)O2 |
| InChI | InChI=1S/C14H19NO2/c1-5-12(16)10-6-7-13-11(8-10)15(4)9-14(2,3)17-13/h6-8H,5,9H2,1-4H3 |
| InChIKey | KHOGCZVNMSWUFU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |