About 2,2-dimethyl-4-propan-2-yl-3H-1,4-benzoxazine-6-sulfonyl chloride
2,2-dimethyl-4-propan-2-yl-3H-1,4-benzoxazine-6-sulfonyl chloride (PubChem CID 82340378) has the molecular formula C13H18ClNO3S
and a molecular weight of 303.81 g/mol. Its IUPAC name is 2,2-dimethyl-4-propan-2-yl-3H-1,4-benzoxazine-6-sulfonyl chloride.
Molecular Properties
| Compound Name | 2,2-dimethyl-4-propan-2-yl-3H-1,4-benzoxazine-6-sulfonyl chloride |
| PubChem CID | 82340378 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2,2-dimethyl-4-propan-2-yl-3H-1,4-benzoxazine-6-sulfonyl chloride |
| SMILES | CC(C)N1CC(C)(C)Oc2ccc(S(=O)(=O)Cl)cc21 |
| InChI | InChI=1S/C13H18ClNO3S/c1-9(2)15-8-13(3,4)18-12-6-5-10(7-11(12)15)19(14,16)17/h5-7,9H,8H2,1-4H3 |
| InChIKey | VKRVWOXIINAKSM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-dimethyl-4-propan-2-yl-3H-1,4-benzoxazine-6-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-4-propan-2-yl-3H-1,4-benzoxazine-6-sulfonyl chloride?
The IUPAC name of 2,2-dimethyl-4-propan-2-yl-3H-1,4-benzoxazine-6-sulfonyl chloride (CID 82340378) is 2,2-dimethyl-4-propan-2-yl-3H-1,4-benzoxazine-6-sulfonyl chloride.
What is the SMILES notation for 2,2-dimethyl-4-propan-2-yl-3H-1,4-benzoxazine-6-sulfonyl chloride?
The canonical SMILES for 2,2-dimethyl-4-propan-2-yl-3H-1,4-benzoxazine-6-sulfonyl chloride is CC(C)N1CC(C)(C)Oc2ccc(S(=O)(=O)Cl)cc21.
What is the InChIKey of 2,2-dimethyl-4-propan-2-yl-3H-1,4-benzoxazine-6-sulfonyl chloride?
The InChIKey is VKRVWOXIINAKSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClNO3S/c1-9(2)15-8-13(3,4)18-12-6-5-10(7-11(12)15)19(14,16)17/h5-7,9H,8H2,1-4H3.
What are the key properties of 2,2-dimethyl-4-propan-2-yl-3H-1,4-benzoxazine-6-sulfonyl chloride?
2,2-dimethyl-4-propan-2-yl-3H-1,4-benzoxazine-6-sulfonyl chloride has a molecular weight of 303.81 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-4-propan-2-yl-3H-1,4-benzoxazine-6-sulfonyl chloride is sourced from PubChem (CID 82340378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).