C16H24N2O2 — CID 82340647
1-[6-(4-aminobutyl)-2,2-dimethyl-3H-1,4-benzoxazin-4-yl]ethanone (PubChem CID 82340647) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-[6-(4-aminobutyl)-2,2-dimethyl-3H-1,4-benzoxazin-4-yl]ethanone.
| Compound Name | 1-[6-(4-aminobutyl)-2,2-dimethyl-3H-1,4-benzoxazin-4-yl]ethanone |
|---|---|
| PubChem CID | 82340647 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-[6-(4-aminobutyl)-2,2-dimethyl-3H-1,4-benzoxazin-4-yl]ethanone |
| SMILES | CC(=O)N1CC(C)(C)Oc2ccc(CCCCN)cc21 |
| InChI | InChI=1S/C16H24N2O2/c1-12(19)18-11-16(2,3)20-15-8-7-13(10-14(15)18)6-4-5-9-17/h7-8,10H,4-6,9,11,17H2,1-3H3 |
| InChIKey | RLUOOJSKOSZGLF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|