C17H16ClN3 — CID 82343068
5-chloro-2-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[1,2-a]pyridin-8-amine (PubChem CID 82343068) has the molecular formula C17H16ClN3 and a molecular weight of 297.79 g/mol. Its IUPAC name is 5-chloro-2-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[1,2-a]pyridin-8-amine.
| Compound Name | 5-chloro-2-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[1,2-a]pyridin-8-amine |
|---|---|
| PubChem CID | 82343068 |
| Molecular Formula | C17H16ClN3 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 5-chloro-2-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[1,2-a]pyridin-8-amine |
| SMILES | Nc1ccc(Cl)n2cc(-c3ccc4c(c3)CCCC4)nc12 |
| InChI | InChI=1S/C17H16ClN3/c18-16-8-7-14(19)17-20-15(10-21(16)17)13-6-5-11-3-1-2-4-12(11)9-13/h5-10H,1-4,19H2 |
| InChIKey | ACHIAFSPLNFWPB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|