About 5-[(2,4,4-trimethylpentan-2-ylamino)methyl]furan-2-amine
5-[(2,4,4-trimethylpentan-2-ylamino)methyl]furan-2-amine (PubChem CID 82344532) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is 5-[(2,4,4-trimethylpentan-2-ylamino)methyl]furan-2-amine.
Molecular Properties
| Compound Name | 5-[(2,4,4-trimethylpentan-2-ylamino)methyl]furan-2-amine |
| PubChem CID | 82344532 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 5-[(2,4,4-trimethylpentan-2-ylamino)methyl]furan-2-amine |
| SMILES | CC(C)(C)CC(C)(C)NCc1ccc(N)o1 |
| InChI | InChI=1S/C13H24N2O/c1-12(2,3)9-13(4,5)15-8-10-6-7-11(14)16-10/h6-7,15H,8-9,14H2,1-5H3 |
| InChIKey | TYXKAJRAPKCOTQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(2,4,4-trimethylpentan-2-ylamino)methyl]furan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,4,4-trimethylpentan-2-ylamino)methyl]furan-2-amine?
The IUPAC name of 5-[(2,4,4-trimethylpentan-2-ylamino)methyl]furan-2-amine (CID 82344532) is 5-[(2,4,4-trimethylpentan-2-ylamino)methyl]furan-2-amine.
What is the SMILES notation for 5-[(2,4,4-trimethylpentan-2-ylamino)methyl]furan-2-amine?
The canonical SMILES for 5-[(2,4,4-trimethylpentan-2-ylamino)methyl]furan-2-amine is CC(C)(C)CC(C)(C)NCc1ccc(N)o1.
What is the InChIKey of 5-[(2,4,4-trimethylpentan-2-ylamino)methyl]furan-2-amine?
The InChIKey is TYXKAJRAPKCOTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O/c1-12(2,3)9-13(4,5)15-8-10-6-7-11(14)16-10/h6-7,15H,8-9,14H2,1-5H3.
What are the key properties of 5-[(2,4,4-trimethylpentan-2-ylamino)methyl]furan-2-amine?
5-[(2,4,4-trimethylpentan-2-ylamino)methyl]furan-2-amine has a molecular weight of 224.35 g/mol, XLogP of 3.17, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,4,4-trimethylpentan-2-ylamino)methyl]furan-2-amine is sourced from PubChem (CID 82344532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).