C16H21NO4 — CID 82345091
2-[bis(prop-2-enyl)amino]-2-(3,4-dimethoxyphenyl)acetic acid (PubChem CID 82345091) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[bis(prop-2-enyl)amino]-2-(3,4-dimethoxyphenyl)acetic acid.
| Compound Name | 2-[bis(prop-2-enyl)amino]-2-(3,4-dimethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 82345091 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-[bis(prop-2-enyl)amino]-2-(3,4-dimethoxyphenyl)acetic acid |
| SMILES | C=CCN(CC=C)C(C(=O)O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H21NO4/c1-5-9-17(10-6-2)15(16(18)19)12-7-8-13(20-3)14(11-12)21-4/h5-8,11,15H,1-2,9-10H2,3-4H3,(H,18,19) |
| InChIKey | SHWMIVZETRMPPX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|