C14H18N2O4 — CID 82345287
butyl 2-(4-amino-2-oxo-1,3-benzoxazol-3-yl)propanoate (PubChem CID 82345287) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is butyl 2-(4-amino-2-oxo-1,3-benzoxazol-3-yl)propanoate.
| Compound Name | butyl 2-(4-amino-2-oxo-1,3-benzoxazol-3-yl)propanoate |
|---|---|
| PubChem CID | 82345287 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | butyl 2-(4-amino-2-oxo-1,3-benzoxazol-3-yl)propanoate |
| SMILES | CCCCOC(=O)C(C)n1c(=O)oc2cccc(N)c21 |
| InChI | InChI=1S/C14H18N2O4/c1-3-4-8-19-13(17)9(2)16-12-10(15)6-5-7-11(12)20-14(16)18/h5-7,9H,3-4,8,15H2,1-2H3 |
| InChIKey | LLKYLRRURKTICP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|