About 3,4,5-trimethyl-N-(4-methylphenyl)-1,3-thiazol-2-imine
3,4,5-trimethyl-N-(4-methylphenyl)-1,3-thiazol-2-imine (PubChem CID 823454) has the molecular formula C13H16N2S
and a molecular weight of 232.35 g/mol. Its IUPAC name is 3,4,5-trimethyl-N-(4-methylphenyl)-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | 3,4,5-trimethyl-N-(4-methylphenyl)-1,3-thiazol-2-imine |
| PubChem CID | 823454 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 3,4,5-trimethyl-N-(4-methylphenyl)-1,3-thiazol-2-imine |
| SMILES | Cc1ccc(/N=c2/sc(C)c(C)n2C)cc1 |
| InChI | InChI=1S/C13H16N2S/c1-9-5-7-12(8-6-9)14-13-15(4)10(2)11(3)16-13/h5-8H,1-4H3/b14-13+ |
| InChIKey | FYXSDUPMYFYPSU-BUHFOSPRSA-N |
| XLogP | 3.24 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze 3,4,5-trimethyl-N-(4-methylphenyl)-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5-trimethyl-N-(4-methylphenyl)-1,3-thiazol-2-imine?
The IUPAC name of 3,4,5-trimethyl-N-(4-methylphenyl)-1,3-thiazol-2-imine (CID 823454) is 3,4,5-trimethyl-N-(4-methylphenyl)-1,3-thiazol-2-imine.
What is the SMILES notation for 3,4,5-trimethyl-N-(4-methylphenyl)-1,3-thiazol-2-imine?
The canonical SMILES for 3,4,5-trimethyl-N-(4-methylphenyl)-1,3-thiazol-2-imine is Cc1ccc(/N=c2/sc(C)c(C)n2C)cc1.
What is the InChIKey of 3,4,5-trimethyl-N-(4-methylphenyl)-1,3-thiazol-2-imine?
The InChIKey is FYXSDUPMYFYPSU-BUHFOSPRSA-N. The full InChI is InChI=1S/C13H16N2S/c1-9-5-7-12(8-6-9)14-13-15(4)10(2)11(3)16-13/h5-8H,1-4H3/b14-13+.
What are the key properties of 3,4,5-trimethyl-N-(4-methylphenyl)-1,3-thiazol-2-imine?
3,4,5-trimethyl-N-(4-methylphenyl)-1,3-thiazol-2-imine has a molecular weight of 232.35 g/mol, XLogP of 3.24, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-trimethyl-N-(4-methylphenyl)-1,3-thiazol-2-imine is sourced from PubChem (CID 823454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).