C13H15N5O2S — CID 82345549
2-(5-amino-2,3-dihydro-1,4-benzoxazin-4-yl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 82345549) has the molecular formula C13H15N5O2S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-(5-amino-2,3-dihydro-1,4-benzoxazin-4-yl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(5-amino-2,3-dihydro-1,4-benzoxazin-4-yl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 82345549 |
| Molecular Formula | C13H15N5O2S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-(5-amino-2,3-dihydro-1,4-benzoxazin-4-yl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | Cc1nnc(NC(=O)CN2CCOc3cccc(N)c32)s1 |
| InChI | InChI=1S/C13H15N5O2S/c1-8-16-17-13(21-8)15-11(19)7-18-5-6-20-10-4-2-3-9(14)12(10)18/h2-4H,5-7,14H2,1H3,(H,15,17,19) |
| InChIKey | IAMLFZPNZJBDCR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|