About 4-prop-2-ynyl-2,3-dihydro-1,4-benzoxazin-5-amine
4-prop-2-ynyl-2,3-dihydro-1,4-benzoxazin-5-amine (PubChem CID 82345572) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-prop-2-ynyl-2,3-dihydro-1,4-benzoxazin-5-amine.
Molecular Properties
| Compound Name | 4-prop-2-ynyl-2,3-dihydro-1,4-benzoxazin-5-amine |
| PubChem CID | 82345572 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 4-prop-2-ynyl-2,3-dihydro-1,4-benzoxazin-5-amine |
| SMILES | C#CCN1CCOc2cccc(N)c21 |
| InChI | InChI=1S/C11H12N2O/c1-2-6-13-7-8-14-10-5-3-4-9(12)11(10)13/h1,3-5H,6-8,12H2 |
| InChIKey | PTYRVXPYCMQHAN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-ynyl-2,3-dihydro-1,4-benzoxazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-ynyl-2,3-dihydro-1,4-benzoxazin-5-amine?
The IUPAC name of 4-prop-2-ynyl-2,3-dihydro-1,4-benzoxazin-5-amine (CID 82345572) is 4-prop-2-ynyl-2,3-dihydro-1,4-benzoxazin-5-amine.
What is the SMILES notation for 4-prop-2-ynyl-2,3-dihydro-1,4-benzoxazin-5-amine?
The canonical SMILES for 4-prop-2-ynyl-2,3-dihydro-1,4-benzoxazin-5-amine is C#CCN1CCOc2cccc(N)c21.
What is the InChIKey of 4-prop-2-ynyl-2,3-dihydro-1,4-benzoxazin-5-amine?
The InChIKey is PTYRVXPYCMQHAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-2-6-13-7-8-14-10-5-3-4-9(12)11(10)13/h1,3-5H,6-8,12H2.
What are the key properties of 4-prop-2-ynyl-2,3-dihydro-1,4-benzoxazin-5-amine?
4-prop-2-ynyl-2,3-dihydro-1,4-benzoxazin-5-amine has a molecular weight of 188.23 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-ynyl-2,3-dihydro-1,4-benzoxazin-5-amine is sourced from PubChem (CID 82345572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).