C12H18N2O3 — CID 82345661
3-(5-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propane-1,2-diol (PubChem CID 82345661) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 3-(5-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propane-1,2-diol.
| Compound Name | 3-(5-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 82345661 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 3-(5-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propane-1,2-diol |
| SMILES | CC1CN(CC(O)CO)c2c(N)cccc2O1 |
| InChI | InChI=1S/C12H18N2O3/c1-8-5-14(6-9(16)7-15)12-10(13)3-2-4-11(12)17-8/h2-4,8-9,15-16H,5-7,13H2,1H3 |
| InChIKey | JZSQRLHQCNXMKR-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|