About 4-(3-methylbutyl)-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-5-amine
4-(3-methylbutyl)-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-5-amine (PubChem CID 82345878) has the molecular formula C16H26N2O
and a molecular weight of 262.40 g/mol. Its IUPAC name is 4-(3-methylbutyl)-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-5-amine.
Molecular Properties
| Compound Name | 4-(3-methylbutyl)-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-5-amine |
| PubChem CID | 82345878 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 4-(3-methylbutyl)-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-5-amine |
| SMILES | CC(C)CCN1CC(C(C)C)Oc2cccc(N)c21 |
| InChI | InChI=1S/C16H26N2O/c1-11(2)8-9-18-10-15(12(3)4)19-14-7-5-6-13(17)16(14)18/h5-7,11-12,15H,8-10,17H2,1-4H3 |
| InChIKey | BDBNLBPYNLNROR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-methylbutyl)-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methylbutyl)-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-5-amine?
The IUPAC name of 4-(3-methylbutyl)-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-5-amine (CID 82345878) is 4-(3-methylbutyl)-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-5-amine.
What is the SMILES notation for 4-(3-methylbutyl)-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-5-amine?
The canonical SMILES for 4-(3-methylbutyl)-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-5-amine is CC(C)CCN1CC(C(C)C)Oc2cccc(N)c21.
What is the InChIKey of 4-(3-methylbutyl)-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-5-amine?
The InChIKey is BDBNLBPYNLNROR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O/c1-11(2)8-9-18-10-15(12(3)4)19-14-7-5-6-13(17)16(14)18/h5-7,11-12,15H,8-10,17H2,1-4H3.
What are the key properties of 4-(3-methylbutyl)-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-5-amine?
4-(3-methylbutyl)-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-5-amine has a molecular weight of 262.40 g/mol, XLogP of 3.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methylbutyl)-2-propan-2-yl-2,3-dihydro-1,4-benzoxazin-5-amine is sourced from PubChem (CID 82345878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).