C16H23N3O2 — CID 82346275
4-butyl-5-piperazin-1-yl-1,4-benzoxazin-3-one (PubChem CID 82346275) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-butyl-5-piperazin-1-yl-1,4-benzoxazin-3-one.
| Compound Name | 4-butyl-5-piperazin-1-yl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82346275 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 4-butyl-5-piperazin-1-yl-1,4-benzoxazin-3-one |
| SMILES | CCCCN1C(=O)COc2cccc(N3CCNCC3)c21 |
| InChI | InChI=1S/C16H23N3O2/c1-2-3-9-19-15(20)12-21-14-6-4-5-13(16(14)19)18-10-7-17-8-11-18/h4-6,17H,2-3,7-12H2,1H3 |
| InChIKey | IQHVIUNKZUFAAE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |