About 4-ethyl-2,2-dimethyl-5-piperazin-1-yl-1,4-benzoxazin-3-one
4-ethyl-2,2-dimethyl-5-piperazin-1-yl-1,4-benzoxazin-3-one (PubChem CID 82346315) has the molecular formula C16H23N3O2
and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-ethyl-2,2-dimethyl-5-piperazin-1-yl-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 4-ethyl-2,2-dimethyl-5-piperazin-1-yl-1,4-benzoxazin-3-one |
| PubChem CID | 82346315 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 4-ethyl-2,2-dimethyl-5-piperazin-1-yl-1,4-benzoxazin-3-one |
| SMILES | CCN1C(=O)C(C)(C)Oc2cccc(N3CCNCC3)c21 |
| InChI | InChI=1S/C16H23N3O2/c1-4-19-14-12(18-10-8-17-9-11-18)6-5-7-13(14)21-16(2,3)15(19)20/h5-7,17H,4,8-11H2,1-3H3 |
| InChIKey | LCYOSUBHDFXKAU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethyl-2,2-dimethyl-5-piperazin-1-yl-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,2-dimethyl-5-piperazin-1-yl-1,4-benzoxazin-3-one?
The IUPAC name of 4-ethyl-2,2-dimethyl-5-piperazin-1-yl-1,4-benzoxazin-3-one (CID 82346315) is 4-ethyl-2,2-dimethyl-5-piperazin-1-yl-1,4-benzoxazin-3-one.
What is the SMILES notation for 4-ethyl-2,2-dimethyl-5-piperazin-1-yl-1,4-benzoxazin-3-one?
The canonical SMILES for 4-ethyl-2,2-dimethyl-5-piperazin-1-yl-1,4-benzoxazin-3-one is CCN1C(=O)C(C)(C)Oc2cccc(N3CCNCC3)c21.
What is the InChIKey of 4-ethyl-2,2-dimethyl-5-piperazin-1-yl-1,4-benzoxazin-3-one?
The InChIKey is LCYOSUBHDFXKAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O2/c1-4-19-14-12(18-10-8-17-9-11-18)6-5-7-13(14)21-16(2,3)15(19)20/h5-7,17H,4,8-11H2,1-3H3.
What are the key properties of 4-ethyl-2,2-dimethyl-5-piperazin-1-yl-1,4-benzoxazin-3-one?
4-ethyl-2,2-dimethyl-5-piperazin-1-yl-1,4-benzoxazin-3-one has a molecular weight of 289.38 g/mol, XLogP of 1.62, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,2-dimethyl-5-piperazin-1-yl-1,4-benzoxazin-3-one is sourced from PubChem (CID 82346315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).