About 3-[4-(4-hydroxyphenyl)-2,6-dioxopiperazin-1-yl]propanenitrile
3-[4-(4-hydroxyphenyl)-2,6-dioxopiperazin-1-yl]propanenitrile (PubChem CID 82346786) has the molecular formula C13H13N3O3
and a molecular weight of 259.26 g/mol. Its IUPAC name is 3-[4-(4-hydroxyphenyl)-2,6-dioxopiperazin-1-yl]propanenitrile.
Molecular Properties
| Compound Name | 3-[4-(4-hydroxyphenyl)-2,6-dioxopiperazin-1-yl]propanenitrile |
| PubChem CID | 82346786 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-[4-(4-hydroxyphenyl)-2,6-dioxopiperazin-1-yl]propanenitrile |
| SMILES | N#CCCN1C(=O)CN(c2ccc(O)cc2)CC1=O |
| InChI | InChI=1S/C13H13N3O3/c14-6-1-7-16-12(18)8-15(9-13(16)19)10-2-4-11(17)5-3-10/h2-5,17H,1,7-9H2 |
| InChIKey | YYUIEKIQTRSNCW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(4-hydroxyphenyl)-2,6-dioxopiperazin-1-yl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4-hydroxyphenyl)-2,6-dioxopiperazin-1-yl]propanenitrile?
The IUPAC name of 3-[4-(4-hydroxyphenyl)-2,6-dioxopiperazin-1-yl]propanenitrile (CID 82346786) is 3-[4-(4-hydroxyphenyl)-2,6-dioxopiperazin-1-yl]propanenitrile.
What is the SMILES notation for 3-[4-(4-hydroxyphenyl)-2,6-dioxopiperazin-1-yl]propanenitrile?
The canonical SMILES for 3-[4-(4-hydroxyphenyl)-2,6-dioxopiperazin-1-yl]propanenitrile is N#CCCN1C(=O)CN(c2ccc(O)cc2)CC1=O.
What is the InChIKey of 3-[4-(4-hydroxyphenyl)-2,6-dioxopiperazin-1-yl]propanenitrile?
The InChIKey is YYUIEKIQTRSNCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O3/c14-6-1-7-16-12(18)8-15(9-13(16)19)10-2-4-11(17)5-3-10/h2-5,17H,1,7-9H2.
What are the key properties of 3-[4-(4-hydroxyphenyl)-2,6-dioxopiperazin-1-yl]propanenitrile?
3-[4-(4-hydroxyphenyl)-2,6-dioxopiperazin-1-yl]propanenitrile has a molecular weight of 259.26 g/mol, XLogP of 0.48, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4-hydroxyphenyl)-2,6-dioxopiperazin-1-yl]propanenitrile is sourced from PubChem (CID 82346786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).