C13H15N3O3S — CID 82346944
2-[4-(2-methoxyphenyl)-2,6-dioxopiperazin-1-yl]ethanethioamide (PubChem CID 82346944) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)-2,6-dioxopiperazin-1-yl]ethanethioamide.
| Compound Name | 2-[4-(2-methoxyphenyl)-2,6-dioxopiperazin-1-yl]ethanethioamide |
|---|---|
| PubChem CID | 82346944 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)-2,6-dioxopiperazin-1-yl]ethanethioamide |
| SMILES | COc1ccccc1N1CC(=O)N(CC(N)=S)C(=O)C1 |
| InChI | InChI=1S/C13H15N3O3S/c1-19-10-5-3-2-4-9(10)15-7-12(17)16(6-11(14)20)13(18)8-15/h2-5H,6-8H2,1H3,(H2,14,20) |
| InChIKey | WURBQNSYTLKTIY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|