C15H22N2O4 — CID 82349138
methyl 4-[4-(dimethylamino)phenyl]-3-(2-hydroxyethylamino)-4-oxobutanoate (PubChem CID 82349138) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl 4-[4-(dimethylamino)phenyl]-3-(2-hydroxyethylamino)-4-oxobutanoate.
| Compound Name | methyl 4-[4-(dimethylamino)phenyl]-3-(2-hydroxyethylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 82349138 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | methyl 4-[4-(dimethylamino)phenyl]-3-(2-hydroxyethylamino)-4-oxobutanoate |
| SMILES | COC(=O)CC(NCCO)C(=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C15H22N2O4/c1-17(2)12-6-4-11(5-7-12)15(20)13(16-8-9-18)10-14(19)21-3/h4-7,13,16,18H,8-10H2,1-3H3 |
| InChIKey | YNTGBJCCSHRMPS-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |