methyl 4-(1-acetyl-2,3-dihydroindol-5-yl)-3-chlorobutanoate

C15H18ClNO3 — CID 82352066

IUPACmethyl 4-(1-acetyl-2,3-dihydroindol-5-yl)-3-chlorobutanoate
SMILESCOC(=O)CC(Cl)Cc1ccc2c(c1)CCN2C(C)=O
InChIInChI=1S/C15H18ClNO3/c1-10(18)17-6-5-12-7-11(3-4-14(12)17)8-13(16)9-15(19)20-2/h3-4,7,13H,5-6,8-9H2,1-2H3
InChIKeyUSOMOFCKTHJGDE-UHFFFAOYSA-N
MW295.77 g/mol
LogP2.31
Rot. Bonds4

About methyl 4-(1-acetyl-2,3-dihydroindol-5-yl)-3-chlorobutanoate

methyl 4-(1-acetyl-2,3-dihydroindol-5-yl)-3-chlorobutanoate (PubChem CID 82352066) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is methyl 4-(1-acetyl-2,3-dihydroindol-5-yl)-3-chlorobutanoate.

Molecular Properties

Compound Namemethyl 4-(1-acetyl-2,3-dihydroindol-5-yl)-3-chlorobutanoate
PubChem CID82352066
Molecular FormulaC15H18ClNO3
Molecular Weight295.77 g/mol
Exact Mass295.10
IUPAC Namemethyl 4-(1-acetyl-2,3-dihydroindol-5-yl)-3-chlorobutanoate
SMILESCOC(=O)CC(Cl)Cc1ccc2c(c1)CCN2C(C)=O
InChIInChI=1S/C15H18ClNO3/c1-10(18)17-6-5-12-7-11(3-4-14(12)17)8-13(16)9-15(19)20-2/h3-4,7,13H,5-6,8-9H2,1-2H3
InChIKeyUSOMOFCKTHJGDE-UHFFFAOYSA-N
XLogP2.31
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.77
LogP ≤ 52.31
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze methyl 4-(1-acetyl-2,3-dihydroindol-5-yl)-3-chlorobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(1-acetyl-2,3-dihydroindol-5-yl)-3-chlorobutanoate?
The IUPAC name of methyl 4-(1-acetyl-2,3-dihydroindol-5-yl)-3-chlorobutanoate (CID 82352066) is methyl 4-(1-acetyl-2,3-dihydroindol-5-yl)-3-chlorobutanoate.
What is the SMILES notation for methyl 4-(1-acetyl-2,3-dihydroindol-5-yl)-3-chlorobutanoate?
The canonical SMILES for methyl 4-(1-acetyl-2,3-dihydroindol-5-yl)-3-chlorobutanoate is COC(=O)CC(Cl)Cc1ccc2c(c1)CCN2C(C)=O.
What is the InChIKey of methyl 4-(1-acetyl-2,3-dihydroindol-5-yl)-3-chlorobutanoate?
The InChIKey is USOMOFCKTHJGDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClNO3/c1-10(18)17-6-5-12-7-11(3-4-14(12)17)8-13(16)9-15(19)20-2/h3-4,7,13H,5-6,8-9H2,1-2H3.
What are the key properties of methyl 4-(1-acetyl-2,3-dihydroindol-5-yl)-3-chlorobutanoate?
methyl 4-(1-acetyl-2,3-dihydroindol-5-yl)-3-chlorobutanoate has a molecular weight of 295.77 g/mol, XLogP of 2.31, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1-acetyl-2,3-dihydroindol-5-yl)-3-chlorobutanoate is sourced from PubChem (CID 82352066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).