About 4-chloro-2,6-dimethylpurino[9,8-a]pyridine
4-chloro-2,6-dimethylpurino[9,8-a]pyridine (PubChem CID 82354810) has the molecular formula C11H9ClN4
and a molecular weight of 232.67 g/mol. Its IUPAC name is 4-chloro-2,6-dimethylpurino[9,8-a]pyridine.
Molecular Properties
| Compound Name | 4-chloro-2,6-dimethylpurino[9,8-a]pyridine |
| PubChem CID | 82354810 |
| Molecular Formula | C11H9ClN4 |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 4-chloro-2,6-dimethylpurino[9,8-a]pyridine |
| SMILES | Cc1nc(Cl)c2nc3c(C)cccn3c2n1 |
| InChI | InChI=1S/C11H9ClN4/c1-6-4-3-5-16-10(6)15-8-9(12)13-7(2)14-11(8)16/h3-5H,1-2H3 |
| InChIKey | NQIQMSBWUILTJN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-2,6-dimethylpurino[9,8-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,6-dimethylpurino[9,8-a]pyridine?
The IUPAC name of 4-chloro-2,6-dimethylpurino[9,8-a]pyridine (CID 82354810) is 4-chloro-2,6-dimethylpurino[9,8-a]pyridine.
What is the SMILES notation for 4-chloro-2,6-dimethylpurino[9,8-a]pyridine?
The canonical SMILES for 4-chloro-2,6-dimethylpurino[9,8-a]pyridine is Cc1nc(Cl)c2nc3c(C)cccn3c2n1.
What is the InChIKey of 4-chloro-2,6-dimethylpurino[9,8-a]pyridine?
The InChIKey is NQIQMSBWUILTJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN4/c1-6-4-3-5-16-10(6)15-8-9(12)13-7(2)14-11(8)16/h3-5H,1-2H3.
What are the key properties of 4-chloro-2,6-dimethylpurino[9,8-a]pyridine?
4-chloro-2,6-dimethylpurino[9,8-a]pyridine has a molecular weight of 232.67 g/mol, XLogP of 2.55, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,6-dimethylpurino[9,8-a]pyridine is sourced from PubChem (CID 82354810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).