About 2-methyl-6-(1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one
2-methyl-6-(1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 82354896) has the molecular formula C12H10N2O2S
and a molecular weight of 246.29 g/mol. Its IUPAC name is 2-methyl-6-(1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 2-methyl-6-(1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one |
| PubChem CID | 82354896 |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2-methyl-6-(1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccc(-c3cscn3)cc2NC1=O |
| InChI | InChI=1S/C12H10N2O2S/c1-7-12(15)14-9-4-8(2-3-11(9)16-7)10-5-17-6-13-10/h2-7H,1H3,(H,14,15) |
| InChIKey | YEXHNCLKHZKQOO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-6-(1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-(1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one?
The IUPAC name of 2-methyl-6-(1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one (CID 82354896) is 2-methyl-6-(1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 2-methyl-6-(1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 2-methyl-6-(1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one is CC1Oc2ccc(-c3cscn3)cc2NC1=O.
What is the InChIKey of 2-methyl-6-(1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one?
The InChIKey is YEXHNCLKHZKQOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2S/c1-7-12(15)14-9-4-8(2-3-11(9)16-7)10-5-17-6-13-10/h2-7H,1H3,(H,14,15).
What are the key properties of 2-methyl-6-(1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one?
2-methyl-6-(1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one has a molecular weight of 246.29 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-(1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 82354896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).