About 2-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]ethanamine
2-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]ethanamine (PubChem CID 82355062) has the molecular formula C12H18N2O3S
and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]ethanamine.
Molecular Properties
| Compound Name | 2-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]ethanamine |
| PubChem CID | 82355062 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]ethanamine |
| SMILES | CCN1CCOc2ccc(S(=O)(=O)CCN)cc21 |
| InChI | InChI=1S/C12H18N2O3S/c1-2-14-6-7-17-12-4-3-10(9-11(12)14)18(15,16)8-5-13/h3-4,9H,2,5-8,13H2,1H3 |
| InChIKey | NLBFNTBAGPKNCU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]ethanamine?
The IUPAC name of 2-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]ethanamine (CID 82355062) is 2-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]ethanamine.
What is the SMILES notation for 2-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]ethanamine?
The canonical SMILES for 2-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]ethanamine is CCN1CCOc2ccc(S(=O)(=O)CCN)cc21.
What is the InChIKey of 2-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]ethanamine?
The InChIKey is NLBFNTBAGPKNCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3S/c1-2-14-6-7-17-12-4-3-10(9-11(12)14)18(15,16)8-5-13/h3-4,9H,2,5-8,13H2,1H3.
What are the key properties of 2-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]ethanamine?
2-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]ethanamine has a molecular weight of 270.35 g/mol, XLogP of 0.64, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]ethanamine is sourced from PubChem (CID 82355062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).