C15H22N2O4S — CID 82355083
6-(3-aminopropylsulfonyl)-2,2-diethyl-4H-1,4-benzoxazin-3-one (PubChem CID 82355083) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 6-(3-aminopropylsulfonyl)-2,2-diethyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(3-aminopropylsulfonyl)-2,2-diethyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82355083 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 6-(3-aminopropylsulfonyl)-2,2-diethyl-4H-1,4-benzoxazin-3-one |
| SMILES | CCC1(CC)Oc2ccc(S(=O)(=O)CCCN)cc2NC1=O |
| InChI | InChI=1S/C15H22N2O4S/c1-3-15(4-2)14(18)17-12-10-11(6-7-13(12)21-15)22(19,20)9-5-8-16/h6-7,10H,3-5,8-9,16H2,1-2H3,(H,17,18) |
| InChIKey | HDJQKLGWMFHHQK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |