About 4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide
4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide (PubChem CID 82355339) has the molecular formula C9H12N2O3S
and a molecular weight of 228.27 g/mol. Its IUPAC name is 4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide.
Molecular Properties
| Compound Name | 4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide |
| PubChem CID | 82355339 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide |
| SMILES | CN1CCOc2ccc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C9H12N2O3S/c1-11-4-5-14-9-3-2-7(6-8(9)11)15(10,12)13/h2-3,6H,4-5H2,1H3,(H2,10,12,13) |
| InChIKey | HFAUGJRUKQKZMS-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide?
The IUPAC name of 4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide (CID 82355339) is 4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide.
What is the SMILES notation for 4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide?
The canonical SMILES for 4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide is CN1CCOc2ccc(S(N)(=O)=O)cc21.
What is the InChIKey of 4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide?
The InChIKey is HFAUGJRUKQKZMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3S/c1-11-4-5-14-9-3-2-7(6-8(9)11)15(10,12)13/h2-3,6H,4-5H2,1H3,(H2,10,12,13).
What are the key properties of 4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide?
4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide has a molecular weight of 228.27 g/mol, XLogP of 0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide is sourced from PubChem (CID 82355339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).