About 3-[(2-methylphenyl)diazenyl]-2-propan-2-ylimidazo[1,2-a]pyridin-8-ol
3-[(2-methylphenyl)diazenyl]-2-propan-2-ylimidazo[1,2-a]pyridin-8-ol (PubChem CID 82355729) has the molecular formula C17H18N4O
and a molecular weight of 294.36 g/mol. Its IUPAC name is 3-[(2-methylphenyl)diazenyl]-2-propan-2-ylimidazo[1,2-a]pyridin-8-ol.
Molecular Properties
| Compound Name | 3-[(2-methylphenyl)diazenyl]-2-propan-2-ylimidazo[1,2-a]pyridin-8-ol |
| PubChem CID | 82355729 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 3-[(2-methylphenyl)diazenyl]-2-propan-2-ylimidazo[1,2-a]pyridin-8-ol |
| SMILES | Cc1ccccc1/N=N/c1c(C(C)C)nc2c(O)cccn12 |
| InChI | InChI=1S/C17H18N4O/c1-11(2)15-17(20-19-13-8-5-4-7-12(13)3)21-10-6-9-14(22)16(21)18-15/h4-11,22H,1-3H3/b20-19+ |
| InChIKey | GVPYGZXCKQFBSO-FMQUCBEESA-N |
| XLogP | 4.89 |
| TPSA | 62.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-methylphenyl)diazenyl]-2-propan-2-ylimidazo[1,2-a]pyridin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methylphenyl)diazenyl]-2-propan-2-ylimidazo[1,2-a]pyridin-8-ol?
The IUPAC name of 3-[(2-methylphenyl)diazenyl]-2-propan-2-ylimidazo[1,2-a]pyridin-8-ol (CID 82355729) is 3-[(2-methylphenyl)diazenyl]-2-propan-2-ylimidazo[1,2-a]pyridin-8-ol.
What is the SMILES notation for 3-[(2-methylphenyl)diazenyl]-2-propan-2-ylimidazo[1,2-a]pyridin-8-ol?
The canonical SMILES for 3-[(2-methylphenyl)diazenyl]-2-propan-2-ylimidazo[1,2-a]pyridin-8-ol is Cc1ccccc1/N=N/c1c(C(C)C)nc2c(O)cccn12.
What is the InChIKey of 3-[(2-methylphenyl)diazenyl]-2-propan-2-ylimidazo[1,2-a]pyridin-8-ol?
The InChIKey is GVPYGZXCKQFBSO-FMQUCBEESA-N. The full InChI is InChI=1S/C17H18N4O/c1-11(2)15-17(20-19-13-8-5-4-7-12(13)3)21-10-6-9-14(22)16(21)18-15/h4-11,22H,1-3H3/b20-19+.
What are the key properties of 3-[(2-methylphenyl)diazenyl]-2-propan-2-ylimidazo[1,2-a]pyridin-8-ol?
3-[(2-methylphenyl)diazenyl]-2-propan-2-ylimidazo[1,2-a]pyridin-8-ol has a molecular weight of 294.36 g/mol, XLogP of 4.89, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methylphenyl)diazenyl]-2-propan-2-ylimidazo[1,2-a]pyridin-8-ol is sourced from PubChem (CID 82355729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).