C14H11N3O2 — CID 82356243
2-(2-methoxyphenyl)-3-nitrosoimidazo[1,2-a]pyridine (PubChem CID 82356243) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-3-nitrosoimidazo[1,2-a]pyridine.
| Compound Name | 2-(2-methoxyphenyl)-3-nitrosoimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 82356243 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-(2-methoxyphenyl)-3-nitrosoimidazo[1,2-a]pyridine |
| SMILES | COc1ccccc1-c1nc2ccccn2c1N=O |
| InChI | InChI=1S/C14H11N3O2/c1-19-11-7-3-2-6-10(11)13-14(16-18)17-9-5-4-8-12(17)15-13/h2-9H,1H3 |
| InChIKey | FCHKOMPHGTUAKV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |