C13H7FN4O3 — CID 82356743
6-fluoro-2-(4-nitrophenyl)-3-nitrosoimidazo[1,2-a]pyridine (PubChem CID 82356743) has the molecular formula C13H7FN4O3 and a molecular weight of 286.22 g/mol. Its IUPAC name is 6-fluoro-2-(4-nitrophenyl)-3-nitrosoimidazo[1,2-a]pyridine.
| Compound Name | 6-fluoro-2-(4-nitrophenyl)-3-nitrosoimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 82356743 |
| Molecular Formula | C13H7FN4O3 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 6-fluoro-2-(4-nitrophenyl)-3-nitrosoimidazo[1,2-a]pyridine |
| SMILES | O=Nc1c(-c2ccc([N+](=O)[O-])cc2)nc2ccc(F)cn12 |
| InChI | InChI=1S/C13H7FN4O3/c14-9-3-6-11-15-12(13(16-19)17(11)7-9)8-1-4-10(5-2-8)18(20)21/h1-7H |
| InChIKey | OXNMTPAALCUQHX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 89.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|