About [2-(trifluoromethyl)-1,3-benzoxazol-6-yl]methanamine
[2-(trifluoromethyl)-1,3-benzoxazol-6-yl]methanamine (PubChem CID 82357482) has the molecular formula C9H7F3N2O
and a molecular weight of 216.16 g/mol. Its IUPAC name is [2-(trifluoromethyl)-1,3-benzoxazol-6-yl]methanamine.
Molecular Properties
| Compound Name | [2-(trifluoromethyl)-1,3-benzoxazol-6-yl]methanamine |
| PubChem CID | 82357482 |
| Molecular Formula | C9H7F3N2O |
| Molecular Weight | 216.16 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | [2-(trifluoromethyl)-1,3-benzoxazol-6-yl]methanamine |
| SMILES | NCc1ccc2nc(C(F)(F)F)oc2c1 |
| InChI | InChI=1S/C9H7F3N2O/c10-9(11,12)8-14-6-2-1-5(4-13)3-7(6)15-8/h1-3H,4,13H2 |
| InChIKey | BMQAANVJSJNFBC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.16 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(trifluoromethyl)-1,3-benzoxazol-6-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(trifluoromethyl)-1,3-benzoxazol-6-yl]methanamine?
The IUPAC name of [2-(trifluoromethyl)-1,3-benzoxazol-6-yl]methanamine (CID 82357482) is [2-(trifluoromethyl)-1,3-benzoxazol-6-yl]methanamine.
What is the SMILES notation for [2-(trifluoromethyl)-1,3-benzoxazol-6-yl]methanamine?
The canonical SMILES for [2-(trifluoromethyl)-1,3-benzoxazol-6-yl]methanamine is NCc1ccc2nc(C(F)(F)F)oc2c1.
What is the InChIKey of [2-(trifluoromethyl)-1,3-benzoxazol-6-yl]methanamine?
The InChIKey is BMQAANVJSJNFBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3N2O/c10-9(11,12)8-14-6-2-1-5(4-13)3-7(6)15-8/h1-3H,4,13H2.
What are the key properties of [2-(trifluoromethyl)-1,3-benzoxazol-6-yl]methanamine?
[2-(trifluoromethyl)-1,3-benzoxazol-6-yl]methanamine has a molecular weight of 216.16 g/mol, XLogP of 2.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(trifluoromethyl)-1,3-benzoxazol-6-yl]methanamine is sourced from PubChem (CID 82357482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).