About 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-diethylacetamide
2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-diethylacetamide (PubChem CID 82358711) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-diethylacetamide |
| PubChem CID | 82358711 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1CCC=CC1CN |
| InChI | InChI=1S/C12H23N3O/c1-3-14(4-2)12(16)10-15-8-6-5-7-11(15)9-13/h5,7,11H,3-4,6,8-10,13H2,1-2H3 |
| InChIKey | MRCKMMXPYKTIQO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-diethylacetamide?
The IUPAC name of 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-diethylacetamide (CID 82358711) is 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-diethylacetamide.
What is the SMILES notation for 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-diethylacetamide?
The canonical SMILES for 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-diethylacetamide is CCN(CC)C(=O)CN1CCC=CC1CN.
What is the InChIKey of 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-diethylacetamide?
The InChIKey is MRCKMMXPYKTIQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O/c1-3-14(4-2)12(16)10-15-8-6-5-7-11(15)9-13/h5,7,11H,3-4,6,8-10,13H2,1-2H3.
What are the key properties of 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-diethylacetamide?
2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-diethylacetamide has a molecular weight of 225.34 g/mol, XLogP of 0.44, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N,N-diethylacetamide is sourced from PubChem (CID 82358711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).