About 2-ethoxyethyl 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate
2-ethoxyethyl 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate (PubChem CID 82358726) has the molecular formula C12H22N2O3
and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate.
Molecular Properties
| Compound Name | 2-ethoxyethyl 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate |
| PubChem CID | 82358726 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 2-ethoxyethyl 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate |
| SMILES | CCOCCOC(=O)CN1CCC=CC1CN |
| InChI | InChI=1S/C12H22N2O3/c1-2-16-7-8-17-12(15)10-14-6-4-3-5-11(14)9-13/h3,5,11H,2,4,6-10,13H2,1H3 |
| InChIKey | RYRKPAUSPUHHHA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethyl 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethyl 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate?
The IUPAC name of 2-ethoxyethyl 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate (CID 82358726) is 2-ethoxyethyl 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate.
What is the SMILES notation for 2-ethoxyethyl 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate?
The canonical SMILES for 2-ethoxyethyl 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate is CCOCCOC(=O)CN1CCC=CC1CN.
What is the InChIKey of 2-ethoxyethyl 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate?
The InChIKey is RYRKPAUSPUHHHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O3/c1-2-16-7-8-17-12(15)10-14-6-4-3-5-11(14)9-13/h3,5,11H,2,4,6-10,13H2,1H3.
What are the key properties of 2-ethoxyethyl 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate?
2-ethoxyethyl 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate has a molecular weight of 242.32 g/mol, XLogP of 0.16, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethyl 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate is sourced from PubChem (CID 82358726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).