About 2-(2-amino-5,6-difluorobenzimidazol-1-yl)-N-methylacetamide
2-(2-amino-5,6-difluorobenzimidazol-1-yl)-N-methylacetamide (PubChem CID 82359191) has the molecular formula C10H10F2N4O
and a molecular weight of 240.21 g/mol. Its IUPAC name is 2-(2-amino-5,6-difluorobenzimidazol-1-yl)-N-methylacetamide.
Molecular Properties
| Compound Name | 2-(2-amino-5,6-difluorobenzimidazol-1-yl)-N-methylacetamide |
| PubChem CID | 82359191 |
| Molecular Formula | C10H10F2N4O |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-(2-amino-5,6-difluorobenzimidazol-1-yl)-N-methylacetamide |
| SMILES | CNC(=O)Cn1c(N)nc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C10H10F2N4O/c1-14-9(17)4-16-8-3-6(12)5(11)2-7(8)15-10(16)13/h2-3H,4H2,1H3,(H2,13,15)(H,14,17) |
| InChIKey | SBGRKTXSTCVZON-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-amino-5,6-difluorobenzimidazol-1-yl)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-5,6-difluorobenzimidazol-1-yl)-N-methylacetamide?
The IUPAC name of 2-(2-amino-5,6-difluorobenzimidazol-1-yl)-N-methylacetamide (CID 82359191) is 2-(2-amino-5,6-difluorobenzimidazol-1-yl)-N-methylacetamide.
What is the SMILES notation for 2-(2-amino-5,6-difluorobenzimidazol-1-yl)-N-methylacetamide?
The canonical SMILES for 2-(2-amino-5,6-difluorobenzimidazol-1-yl)-N-methylacetamide is CNC(=O)Cn1c(N)nc2cc(F)c(F)cc21.
What is the InChIKey of 2-(2-amino-5,6-difluorobenzimidazol-1-yl)-N-methylacetamide?
The InChIKey is SBGRKTXSTCVZON-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2N4O/c1-14-9(17)4-16-8-3-6(12)5(11)2-7(8)15-10(16)13/h2-3H,4H2,1H3,(H2,13,15)(H,14,17).
What are the key properties of 2-(2-amino-5,6-difluorobenzimidazol-1-yl)-N-methylacetamide?
2-(2-amino-5,6-difluorobenzimidazol-1-yl)-N-methylacetamide has a molecular weight of 240.21 g/mol, XLogP of 0.64, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-5,6-difluorobenzimidazol-1-yl)-N-methylacetamide is sourced from PubChem (CID 82359191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).