About N-ethyl-5,6-dimethoxy-1-prop-2-enylbenzimidazol-2-amine
N-ethyl-5,6-dimethoxy-1-prop-2-enylbenzimidazol-2-amine (PubChem CID 82359667) has the molecular formula C14H19N3O2
and a molecular weight of 261.32 g/mol. Its IUPAC name is N-ethyl-5,6-dimethoxy-1-prop-2-enylbenzimidazol-2-amine.
Molecular Properties
| Compound Name | N-ethyl-5,6-dimethoxy-1-prop-2-enylbenzimidazol-2-amine |
| PubChem CID | 82359667 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-ethyl-5,6-dimethoxy-1-prop-2-enylbenzimidazol-2-amine |
| SMILES | C=CCn1c(NCC)nc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C14H19N3O2/c1-5-7-17-11-9-13(19-4)12(18-3)8-10(11)16-14(17)15-6-2/h5,8-9H,1,6-7H2,2-4H3,(H,15,16) |
| InChIKey | RWEMOLAZGLEKJH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-5,6-dimethoxy-1-prop-2-enylbenzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5,6-dimethoxy-1-prop-2-enylbenzimidazol-2-amine?
The IUPAC name of N-ethyl-5,6-dimethoxy-1-prop-2-enylbenzimidazol-2-amine (CID 82359667) is N-ethyl-5,6-dimethoxy-1-prop-2-enylbenzimidazol-2-amine.
What is the SMILES notation for N-ethyl-5,6-dimethoxy-1-prop-2-enylbenzimidazol-2-amine?
The canonical SMILES for N-ethyl-5,6-dimethoxy-1-prop-2-enylbenzimidazol-2-amine is C=CCn1c(NCC)nc2cc(OC)c(OC)cc21.
What is the InChIKey of N-ethyl-5,6-dimethoxy-1-prop-2-enylbenzimidazol-2-amine?
The InChIKey is RWEMOLAZGLEKJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2/c1-5-7-17-11-9-13(19-4)12(18-3)8-10(11)16-14(17)15-6-2/h5,8-9H,1,6-7H2,2-4H3,(H,15,16).
What are the key properties of N-ethyl-5,6-dimethoxy-1-prop-2-enylbenzimidazol-2-amine?
N-ethyl-5,6-dimethoxy-1-prop-2-enylbenzimidazol-2-amine has a molecular weight of 261.32 g/mol, XLogP of 2.67, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5,6-dimethoxy-1-prop-2-enylbenzimidazol-2-amine is sourced from PubChem (CID 82359667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).